C18H17ClN2O5S — CID 7629838
[2-[2-(4-chlorophenyl)sulfanylethylamino]-2-oxoethyl] 4-methyl-3-nitrobenzoate (PubChem CID 7629838) has the molecular formula C18H17ClN2O5S and a molecular weight of 408.86 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)sulfanylethylamino]-2-oxoethyl] 4-methyl-3-nitrobenzoate.
| Compound Name | [2-[2-(4-chlorophenyl)sulfanylethylamino]-2-oxoethyl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7629838 |
| Molecular Formula | C18H17ClN2O5S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [2-[2-(4-chlorophenyl)sulfanylethylamino]-2-oxoethyl] 4-methyl-3-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NCCSc2ccc(Cl)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17ClN2O5S/c1-12-2-3-13(10-16(12)21(24)25)18(23)26-11-17(22)20-8-9-27-15-6-4-14(19)5-7-15/h2-7,10H,8-9,11H2,1H3,(H,20,22) |
| InChIKey | ACRXILBNAQFCQZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|