C22H22N4O12 — CID 16796657
[2-[2-[[2-(4-methoxy-3-nitrobenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 4-methoxy-3-nitrobenzoate (PubChem CID 16796657) has the molecular formula C22H22N4O12 and a molecular weight of 534.43 g/mol. Its IUPAC name is [2-[2-[[2-(4-methoxy-3-nitrobenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 4-methoxy-3-nitrobenzoate.
| Compound Name | [2-[2-[[2-(4-methoxy-3-nitrobenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 4-methoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 16796657 |
| Molecular Formula | C22H22N4O12 |
| Molecular Weight | 534.43 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | [2-[2-[[2-(4-methoxy-3-nitrobenzoyl)oxyacetyl]amino]ethylamino]-2-oxoethyl] 4-methoxy-3-nitrobenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NCCNC(=O)COC(=O)c2ccc(OC)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H22N4O12/c1-35-17-5-3-13(9-15(17)25(31)32)21(29)37-11-19(27)23-7-8-24-20(28)12-38-22(30)14-4-6-18(36-2)16(10-14)26(33)34/h3-6,9-10H,7-8,11-12H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | SVNNJSOONHSSQT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 215.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|