C16H21N3O7 — CID 9290468
[2-oxo-2-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 4-methoxy-3-nitrobenzoate (PubChem CID 9290468) has the molecular formula C16H21N3O7 and a molecular weight of 367.36 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 4-methoxy-3-nitrobenzoate.
| Compound Name | [2-oxo-2-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 4-methoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 9290468 |
| Molecular Formula | C16H21N3O7 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [2-oxo-2-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 4-methoxy-3-nitrobenzoate |
| SMILES | CCCNC(=O)[C@@H](C)NC(=O)COC(=O)c1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H21N3O7/c1-4-7-17-15(21)10(2)18-14(20)9-26-16(22)11-5-6-13(25-3)12(8-11)19(23)24/h5-6,8,10H,4,7,9H2,1-3H3,(H,17,21)(H,18,20)/t10-/m1/s1 |
| InChIKey | PMXHARALQKWHSK-SNVBAGLBSA-N |
| XLogP | 0.79 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|