C15H20N2O6 — CID 9388457
[2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 4-ethoxy-3-nitrobenzoate (PubChem CID 9388457) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 4-ethoxy-3-nitrobenzoate.
| Compound Name | [2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 4-ethoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 9388457 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]amino]-2-oxoethyl] 4-ethoxy-3-nitrobenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)N[C@@H](C)CC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N2O6/c1-4-10(3)16-14(18)9-23-15(19)11-6-7-13(22-5-2)12(8-11)17(20)21/h6-8,10H,4-5,9H2,1-3H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | GMQWRLMGVKERKQ-JTQLQIEISA-N |
| XLogP | 2.07 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|