C14H16N2O6 — CID 9390119
[2-(cyclopropylamino)-2-oxoethyl] 4-ethoxy-3-nitrobenzoate (PubChem CID 9390119) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 4-ethoxy-3-nitrobenzoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 4-ethoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 9390119 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 4-ethoxy-3-nitrobenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)NC2CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N2O6/c1-2-21-12-6-3-9(7-11(12)16(19)20)14(18)22-8-13(17)15-10-4-5-10/h3,6-7,10H,2,4-5,8H2,1H3,(H,15,17) |
| InChIKey | WYQCMNMYGBZKSF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|