C20H29NO5 — CID 7042976
[2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 3,4-diethoxybenzoate (PubChem CID 7042976) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 3,4-diethoxybenzoate.
| Compound Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 7042976 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)NC2CCC(C)CC2)cc1OCC |
| InChI | InChI=1S/C20H29NO5/c1-4-24-17-11-8-15(12-18(17)25-5-2)20(23)26-13-19(22)21-16-9-6-14(3)7-10-16/h8,11-12,14,16H,4-7,9-10,13H2,1-3H3,(H,21,22) |
| InChIKey | LZODOHUHMCMABZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |