C18H25NO5 — CID 2540841
[2-(cyclopropylamino)-2-oxoethyl] 4-butoxy-3-ethoxybenzoate (PubChem CID 2540841) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 4-butoxy-3-ethoxybenzoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 4-butoxy-3-ethoxybenzoate |
|---|---|
| PubChem CID | 2540841 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 4-butoxy-3-ethoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)NC2CC2)cc1OCC |
| InChI | InChI=1S/C18H25NO5/c1-3-5-10-23-15-9-6-13(11-16(15)22-4-2)18(21)24-12-17(20)19-14-7-8-14/h6,9,11,14H,3-5,7-8,10,12H2,1-2H3,(H,19,20) |
| InChIKey | NQQIIIUHSATCBV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|