C22H26ClNO5 — CID 7904228
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate (PubChem CID 7904228) has the molecular formula C22H26ClNO5 and a molecular weight of 419.91 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate.
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate |
|---|---|
| PubChem CID | 7904228 |
| Molecular Formula | C22H26ClNO5 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)NCc2ccc(Cl)cc2)cc1OCC |
| InChI | InChI=1S/C22H26ClNO5/c1-3-5-12-28-19-11-8-17(13-20(19)27-4-2)22(26)29-15-21(25)24-14-16-6-9-18(23)10-7-16/h6-11,13H,3-5,12,14-15H2,1-2H3,(H,24,25) |
| InChIKey | WCZUWAQDNFUNBC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|