C26H33NO6 — CID 32796960
[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate (PubChem CID 32796960) has the molecular formula C26H33NO6 and a molecular weight of 455.55 g/mol. Its IUPAC name is [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate.
| Compound Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate |
|---|---|
| PubChem CID | 32796960 |
| Molecular Formula | C26H33NO6 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)c2ccc(CCCNC(C)=O)cc2)cc1OCC |
| InChI | InChI=1S/C26H33NO6/c1-4-6-16-32-24-14-13-22(17-25(24)31-5-2)26(30)33-18-23(29)21-11-9-20(10-12-21)8-7-15-27-19(3)28/h9-14,17H,4-8,15-16,18H2,1-3H3,(H,27,28) |
| InChIKey | GLLKGNFBPNHEBR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|