C21H21NO6 — CID 7627988
[2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 7627988) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 7627988 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | [2-[4-(3-acetamidopropyl)phenyl]-2-oxoethyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | CC(=O)NCCCc1ccc(C(=O)COC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C21H21NO6/c1-14(23)22-10-2-3-15-4-6-16(7-5-15)18(24)12-26-21(25)17-8-9-19-20(11-17)28-13-27-19/h4-9,11H,2-3,10,12-13H2,1H3,(H,22,23) |
| InChIKey | TVGVTZAHOIHLBT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|