C21H25NO6S — CID 27315281
[2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 3,4-diethoxybenzoate (PubChem CID 27315281) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is [2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 3,4-diethoxybenzoate.
| Compound Name | [2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 27315281 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)c2ccc(CCNC(C)=O)s2)cc1OCC |
| InChI | InChI=1S/C21H25NO6S/c1-4-26-18-8-6-15(12-19(18)27-5-2)21(25)28-13-17(24)20-9-7-16(29-20)10-11-22-14(3)23/h6-9,12H,4-5,10-11,13H2,1-3H3,(H,22,23) |
| InChIKey | SJPSDKYTIQNYAV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |