C18H17F2NO5S — CID 18100897
[2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 2-(difluoromethoxy)benzoate (PubChem CID 18100897) has the molecular formula C18H17F2NO5S and a molecular weight of 397.40 g/mol. Its IUPAC name is [2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 2-(difluoromethoxy)benzoate.
| Compound Name | [2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 2-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 18100897 |
| Molecular Formula | C18H17F2NO5S |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 2-(difluoromethoxy)benzoate |
| SMILES | CC(=O)NCCc1ccc(C(=O)COC(=O)c2ccccc2OC(F)F)s1 |
| InChI | InChI=1S/C18H17F2NO5S/c1-11(22)21-9-8-12-6-7-16(27-12)14(23)10-25-17(24)13-4-2-3-5-15(13)26-18(19)20/h2-7,18H,8-10H2,1H3,(H,21,22) |
| InChIKey | UKDXBMGAUMOZRN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |