C25H31NO6 — CID 16556641
[2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate (PubChem CID 16556641) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate.
| Compound Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate |
|---|---|
| PubChem CID | 16556641 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)c2ccc(NC(=O)CCC)cc2)cc1OCC |
| InChI | InChI=1S/C25H31NO6/c1-4-7-15-31-22-14-11-19(16-23(22)30-6-3)25(29)32-17-21(27)18-9-12-20(13-10-18)26-24(28)8-5-2/h9-14,16H,4-8,15,17H2,1-3H3,(H,26,28) |
| InChIKey | IRSSLWBHGISAKJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|