C27H37N3O5 — CID 16625247
[2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate (PubChem CID 16625247) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate.
| Compound Name | [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate |
|---|---|
| PubChem CID | 16625247 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | [2-[4-(4-ethylpiperazin-1-yl)anilino]-2-oxoethyl] 4-butoxy-3-ethoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(=O)Nc2ccc(N3CCN(CC)CC3)cc2)cc1OCC |
| InChI | InChI=1S/C27H37N3O5/c1-4-7-18-34-24-13-8-21(19-25(24)33-6-3)27(32)35-20-26(31)28-22-9-11-23(12-10-22)30-16-14-29(5-2)15-17-30/h8-13,19H,4-7,14-18,20H2,1-3H3,(H,28,31) |
| InChIKey | IUDCKBLKHPUHIB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|