C22H26N2O6 — CID 2561915
[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3,4-diethoxybenzoate (PubChem CID 2561915) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3,4-diethoxybenzoate.
| Compound Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 2561915 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)Nc2ccc(C(=O)N(C)C)cc2)cc1OCC |
| InChI | InChI=1S/C22H26N2O6/c1-5-28-18-12-9-16(13-19(18)29-6-2)22(27)30-14-20(25)23-17-10-7-15(8-11-17)21(26)24(3)4/h7-13H,5-6,14H2,1-4H3,(H,23,25) |
| InChIKey | DDWWPGPBVLAZCF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |