C23H23NO5 — CID 7698271
[2-(3,4-diethoxyanilino)-2-oxoethyl] naphthalene-2-carboxylate (PubChem CID 7698271) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] naphthalene-2-carboxylate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7698271 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] naphthalene-2-carboxylate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2ccc3ccccc3c2)cc1OCC |
| InChI | InChI=1S/C23H23NO5/c1-3-27-20-12-11-19(14-21(20)28-4-2)24-22(25)15-29-23(26)18-10-9-16-7-5-6-8-17(16)13-18/h5-14H,3-4,15H2,1-2H3,(H,24,25) |
| InChIKey | VLABVKSRSZJFPR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |