C26H25NO6 — CID 71905011
[2-(3,4-diethoxyanilino)-2-oxoethyl] 2-benzoylbenzoate (PubChem CID 71905011) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 2-benzoylbenzoate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 71905011 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 2-benzoylbenzoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2ccccc2C(=O)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C26H25NO6/c1-3-31-22-15-14-19(16-23(22)32-4-2)27-24(28)17-33-26(30)21-13-9-8-12-20(21)25(29)18-10-6-5-7-11-18/h5-16H,3-4,17H2,1-2H3,(H,27,28) |
| InChIKey | NKOKOBFDXQUROX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |