C24H20N2O5 — CID 2621873
[2-(4-acetamidoanilino)-2-oxoethyl] 2-benzoylbenzoate (PubChem CID 2621873) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 2-benzoylbenzoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 2621873 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2-benzoylbenzoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)c2ccccc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N2O5/c1-16(27)25-18-11-13-19(14-12-18)26-22(28)15-31-24(30)21-10-6-5-9-20(21)23(29)17-7-3-2-4-8-17/h2-14H,15H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | SMWMGFIHNISRIZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |