C23H18ClNO5 — CID 2335269
[2-(4-methoxyanilino)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate (PubChem CID 2335269) has the molecular formula C23H18ClNO5 and a molecular weight of 423.85 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate |
|---|---|
| PubChem CID | 2335269 |
| Molecular Formula | C23H18ClNO5 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 2-(4-chlorobenzoyl)benzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2ccccc2C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H18ClNO5/c1-29-18-12-10-17(11-13-18)25-21(26)14-30-23(28)20-5-3-2-4-19(20)22(27)15-6-8-16(24)9-7-15/h2-13H,14H2,1H3,(H,25,26) |
| InChIKey | AVQYEBWYWJCXLJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |