C31H22N2O7 — CID 16618617
[2-[4-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 16618617) has the molecular formula C31H22N2O7 and a molecular weight of 534.52 g/mol. Its IUPAC name is [2-[4-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-[4-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 16618617 |
| Molecular Formula | C31H22N2O7 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | [2-[4-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | COc1ccc(NC(=O)c2ccc(NC(=O)COC(=O)c3cccc4c3C(=O)c3ccccc3C4=O)cc2)cc1 |
| InChI | InChI=1S/C31H22N2O7/c1-39-21-15-13-20(14-16-21)33-30(37)18-9-11-19(12-10-18)32-26(34)17-40-31(38)25-8-4-7-24-27(25)29(36)23-6-3-2-5-22(23)28(24)35/h2-16H,17H2,1H3,(H,32,34)(H,33,37) |
| InChIKey | DHCPBQUENKBDDE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|