C24H16N2O6 — CID 4148132
[2-(4-carbamoylanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 4148132) has the molecular formula C24H16N2O6 and a molecular weight of 428.40 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 4148132 |
| Molecular Formula | C24H16N2O6 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | NC(=O)c1ccc(NC(=O)COC(=O)c2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C24H16N2O6/c25-23(30)13-8-10-14(11-9-13)26-19(27)12-32-24(31)18-7-3-6-17-20(18)22(29)16-5-2-1-4-15(16)21(17)28/h1-11H,12H2,(H2,25,30)(H,26,27) |
| InChIKey | LGCNKGGTUDIQRP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|