C23H14N2O7 — CID 3648997
[2-(3-nitroanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 3648997) has the molecular formula C23H14N2O7 and a molecular weight of 430.37 g/mol. Its IUPAC name is [2-(3-nitroanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-(3-nitroanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 3648997 |
| Molecular Formula | C23H14N2O7 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | [2-(3-nitroanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | O=C(COC(=O)c1cccc2c1C(=O)c1ccccc1C2=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H14N2O7/c26-19(24-13-5-3-6-14(11-13)25(30)31)12-32-23(29)18-10-4-9-17-20(18)22(28)16-8-2-1-7-15(16)21(17)27/h1-11H,12H2,(H,24,26) |
| InChIKey | NUBWPAGYYHJIEM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|