About [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate
[2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate (PubChem CID 9387832) has the molecular formula C15H10BrFN2O5
and a molecular weight of 397.16 g/mol. Its IUPAC name is [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate.
Molecular Properties
| Compound Name | [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate |
| PubChem CID | 9387832 |
| Molecular Formula | C15H10BrFN2O5 |
| Molecular Weight | 397.16 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Br)cc1F)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10BrFN2O5/c16-9-4-5-12(13(17)6-9)15(21)24-8-14(20)18-10-2-1-3-11(7-10)19(22)23/h1-7H,8H2,(H,18,20) |
| InChIKey | YMPXGHVFGPXSCQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.16 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate?
The IUPAC name of [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate (CID 9387832) is [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate.
What is the SMILES notation for [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate?
The canonical SMILES for [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate is O=C(COC(=O)c1ccc(Br)cc1F)Nc1cccc([N+](=O)[O-])c1.
What is the InChIKey of [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate?
The InChIKey is YMPXGHVFGPXSCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrFN2O5/c16-9-4-5-12(13(17)6-9)15(21)24-8-14(20)18-10-2-1-3-11(7-10)19(22)23/h1-7H,8H2,(H,18,20).
What are the key properties of [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate?
[2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate has a molecular weight of 397.16 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-nitroanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate is sourced from PubChem (CID 9387832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).