C13H10N4O7 — CID 2100965
[2-(3-nitroanilino)-2-oxoethyl] 2,4-dioxo-1H-pyrimidine-5-carboxylate (PubChem CID 2100965) has the molecular formula C13H10N4O7 and a molecular weight of 334.24 g/mol. Its IUPAC name is [2-(3-nitroanilino)-2-oxoethyl] 2,4-dioxo-1H-pyrimidine-5-carboxylate.
| Compound Name | [2-(3-nitroanilino)-2-oxoethyl] 2,4-dioxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2100965 |
| Molecular Formula | C13H10N4O7 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | [2-(3-nitroanilino)-2-oxoethyl] 2,4-dioxo-1H-pyrimidine-5-carboxylate |
| SMILES | O=C(COC(=O)c1c[nH]c(=O)[nH]c1=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N4O7/c18-10(15-7-2-1-3-8(4-7)17(22)23)6-24-12(20)9-5-14-13(21)16-11(9)19/h1-5H,6H2,(H,15,18)(H2,14,16,19,21) |
| InChIKey | FTHKCTBVAMXRML-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 164.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|