C17H15BrFNO3 — CID 9387809
[2-(3,5-dimethylanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate (PubChem CID 9387809) has the molecular formula C17H15BrFNO3 and a molecular weight of 380.21 g/mol. Its IUPAC name is [2-(3,5-dimethylanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate.
| Compound Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate |
|---|---|
| PubChem CID | 9387809 |
| Molecular Formula | C17H15BrFNO3 |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | [2-(3,5-dimethylanilino)-2-oxoethyl] 4-bromo-2-fluorobenzoate |
| SMILES | Cc1cc(C)cc(NC(=O)COC(=O)c2ccc(Br)cc2F)c1 |
| InChI | InChI=1S/C17H15BrFNO3/c1-10-5-11(2)7-13(6-10)20-16(21)9-23-17(22)14-4-3-12(18)8-15(14)19/h3-8H,9H2,1-2H3,(H,20,21) |
| InChIKey | ODXMQHQVGWJURY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |