C13H15BrFNO3 — CID 9387877
[2-(2-methylpropylamino)-2-oxoethyl] 4-bromo-2-fluorobenzoate (PubChem CID 9387877) has the molecular formula C13H15BrFNO3 and a molecular weight of 332.17 g/mol. Its IUPAC name is [2-(2-methylpropylamino)-2-oxoethyl] 4-bromo-2-fluorobenzoate.
| Compound Name | [2-(2-methylpropylamino)-2-oxoethyl] 4-bromo-2-fluorobenzoate |
|---|---|
| PubChem CID | 9387877 |
| Molecular Formula | C13H15BrFNO3 |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | [2-(2-methylpropylamino)-2-oxoethyl] 4-bromo-2-fluorobenzoate |
| SMILES | CC(C)CNC(=O)COC(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C13H15BrFNO3/c1-8(2)6-16-12(17)7-19-13(18)10-4-3-9(14)5-11(10)15/h3-5,8H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | ZESDNOHXVOIOGY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |