C20H28N2O6 — CID 7775398
bis[2-(2-methylpropylamino)-2-oxoethyl] benzene-1,4-dicarboxylate (PubChem CID 7775398) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is bis[2-(2-methylpropylamino)-2-oxoethyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[2-(2-methylpropylamino)-2-oxoethyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 7775398 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | bis[2-(2-methylpropylamino)-2-oxoethyl] benzene-1,4-dicarboxylate |
| SMILES | CC(C)CNC(=O)COC(=O)c1ccc(C(=O)OCC(=O)NCC(C)C)cc1 |
| InChI | InChI=1S/C20H28N2O6/c1-13(2)9-21-17(23)11-27-19(25)15-5-7-16(8-6-15)20(26)28-12-18(24)22-10-14(3)4/h5-8,13-14H,9-12H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | CMPMODQGFLIVBW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |