C13H16FNO3 — CID 4125940
[2-(2-methylpropylamino)-2-oxoethyl] 3-fluorobenzoate (PubChem CID 4125940) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is [2-(2-methylpropylamino)-2-oxoethyl] 3-fluorobenzoate.
| Compound Name | [2-(2-methylpropylamino)-2-oxoethyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 4125940 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | [2-(2-methylpropylamino)-2-oxoethyl] 3-fluorobenzoate |
| SMILES | CC(C)CNC(=O)COC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C13H16FNO3/c1-9(2)7-15-12(16)8-18-13(17)10-4-3-5-11(14)6-10/h3-6,9H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | ZXTJXMBPBITQAK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |