C16H12F3NO3 — CID 46860456
[2-[(2,4-difluorophenyl)methylamino]-2-oxoethyl] 3-fluorobenzoate (PubChem CID 46860456) has the molecular formula C16H12F3NO3 and a molecular weight of 323.27 g/mol. Its IUPAC name is [2-[(2,4-difluorophenyl)methylamino]-2-oxoethyl] 3-fluorobenzoate.
| Compound Name | [2-[(2,4-difluorophenyl)methylamino]-2-oxoethyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 46860456 |
| Molecular Formula | C16H12F3NO3 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | [2-[(2,4-difluorophenyl)methylamino]-2-oxoethyl] 3-fluorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(F)c1)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C16H12F3NO3/c17-12-3-1-2-10(6-12)16(22)23-9-15(21)20-8-11-4-5-13(18)7-14(11)19/h1-7H,8-9H2,(H,20,21) |
| InChIKey | XPOCKNHIAXRDGS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |