C16H12BrF2NO3 — CID 50929658
[2-[(2-bromophenyl)methylamino]-2-oxoethyl] 3,5-difluorobenzoate (PubChem CID 50929658) has the molecular formula C16H12BrF2NO3 and a molecular weight of 384.18 g/mol. Its IUPAC name is [2-[(2-bromophenyl)methylamino]-2-oxoethyl] 3,5-difluorobenzoate.
| Compound Name | [2-[(2-bromophenyl)methylamino]-2-oxoethyl] 3,5-difluorobenzoate |
|---|---|
| PubChem CID | 50929658 |
| Molecular Formula | C16H12BrF2NO3 |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | [2-[(2-bromophenyl)methylamino]-2-oxoethyl] 3,5-difluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)cc(F)c1)NCc1ccccc1Br |
| InChI | InChI=1S/C16H12BrF2NO3/c17-14-4-2-1-3-10(14)8-20-15(21)9-23-16(22)11-5-12(18)7-13(19)6-11/h1-7H,8-9H2,(H,20,21) |
| InChIKey | BCGNLUFAGZKZNZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |