C16H12ClF2NO4 — CID 99799793
[2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-chloro-5-fluoro-4-hydroxybenzoate (PubChem CID 99799793) has the molecular formula C16H12ClF2NO4 and a molecular weight of 355.72 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-chloro-5-fluoro-4-hydroxybenzoate.
| Compound Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-chloro-5-fluoro-4-hydroxybenzoate |
|---|---|
| PubChem CID | 99799793 |
| Molecular Formula | C16H12ClF2NO4 |
| Molecular Weight | 355.72 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-chloro-5-fluoro-4-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(F)c(O)c(Cl)c1)NCc1ccccc1F |
| InChI | InChI=1S/C16H12ClF2NO4/c17-11-5-10(6-13(19)15(11)22)16(23)24-8-14(21)20-7-9-3-1-2-4-12(9)18/h1-6,22H,7-8H2,(H,20,21) |
| InChIKey | GTZSPLSBTMBGTG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |