C20H17FN2O5 — CID 8808618
[2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 8808618) has the molecular formula C20H17FN2O5 and a molecular weight of 384.36 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 8808618 |
| Molecular Formula | C20H17FN2O5 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(N2C(=O)CCC2=O)c1)NCc1ccccc1F |
| InChI | InChI=1S/C20H17FN2O5/c21-16-7-2-1-4-14(16)11-22-17(24)12-28-20(27)13-5-3-6-15(10-13)23-18(25)8-9-19(23)26/h1-7,10H,8-9,11-12H2,(H,22,24) |
| InChIKey | XOSDFCYLEJYEAG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|