C21H18BrN3O6 — CID 34651517
[2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 34651517) has the molecular formula C21H18BrN3O6 and a molecular weight of 488.29 g/mol. Its IUPAC name is [2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 34651517 |
| Molecular Formula | C21H18BrN3O6 |
| Molecular Weight | 488.29 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | [2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(N2C(=O)CCC2=O)c1)NCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C21H18BrN3O6/c22-15-6-1-2-7-16(15)24-17(26)11-23-18(27)12-31-21(30)13-4-3-5-14(10-13)25-19(28)8-9-20(25)29/h1-7,10H,8-9,11-12H2,(H,23,27)(H,24,26) |
| InChIKey | OYSQDIDFIHKEAR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|