C16H14BrN3O5 — CID 9346632
[2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 9346632) has the molecular formula C16H14BrN3O5 and a molecular weight of 408.21 g/mol. Its IUPAC name is [2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | [2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 9346632 |
| Molecular Formula | C16H14BrN3O5 |
| Molecular Weight | 408.21 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | [2-[[2-(2-bromoanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc[n+]([O-])cc1)NCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C16H14BrN3O5/c17-12-3-1-2-4-13(12)19-14(21)9-18-15(22)10-25-16(23)11-5-7-20(24)8-6-11/h1-8H,9-10H2,(H,18,22)(H,19,21) |
| InChIKey | OINHSOHXTLHCSK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|