C16H13F2N3O5 — CID 9346635
[2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 9346635) has the molecular formula C16H13F2N3O5 and a molecular weight of 365.29 g/mol. Its IUPAC name is [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 9346635 |
| Molecular Formula | C16H13F2N3O5 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc[n+]([O-])cc1)NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H13F2N3O5/c17-12-2-1-11(7-13(12)18)20-14(22)8-19-15(23)9-26-16(24)10-3-5-21(25)6-4-10/h1-7H,8-9H2,(H,19,23)(H,20,22) |
| InChIKey | DQIKIBDVXJMWSF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|