C25H17F2N3O6 — CID 34512063
[2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 34512063) has the molecular formula C25H17F2N3O6 and a molecular weight of 493.42 g/mol. Its IUPAC name is [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 34512063 |
| Molecular Formula | C25H17F2N3O6 |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | [2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1)NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C25H17F2N3O6/c26-19-10-7-15(11-20(19)27)29-21(31)12-28-22(32)13-36-25(35)14-5-8-16(9-6-14)30-23(33)17-3-1-2-4-18(17)24(30)34/h1-11H,12-13H2,(H,28,32)(H,29,31) |
| InChIKey | ZLZRNBLQHHXOSX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|