C24H16F2N2O5 — CID 35165518
[2-(3,4-difluoroanilino)-2-oxoethyl] 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoate (PubChem CID 35165518) has the molecular formula C24H16F2N2O5 and a molecular weight of 450.40 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 35165518 |
| Molecular Formula | C24H16F2N2O5 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(CN2C(=O)c3ccccc3C2=O)cc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C24H16F2N2O5/c25-19-10-9-16(11-20(19)26)27-21(29)13-33-24(32)15-7-5-14(6-8-15)12-28-22(30)17-3-1-2-4-18(17)23(28)31/h1-11H,12-13H2,(H,27,29) |
| InChIKey | GIQBTZKLPGRSQI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|