C22H15F2NO4 — CID 7203949
[2-(3,4-difluoroanilino)-2-oxoethyl] 4-benzoylbenzoate (PubChem CID 7203949) has the molecular formula C22H15F2NO4 and a molecular weight of 395.36 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 4-benzoylbenzoate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 4-benzoylbenzoate |
|---|---|
| PubChem CID | 7203949 |
| Molecular Formula | C22H15F2NO4 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 4-benzoylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(C(=O)c2ccccc2)cc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H15F2NO4/c23-18-11-10-17(12-19(18)24)25-20(26)13-29-22(28)16-8-6-15(7-9-16)21(27)14-4-2-1-3-5-14/h1-12H,13H2,(H,25,26) |
| InChIKey | CMJPFMGTIQUYBU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |