C13H9F2NO3S — CID 3687826
[2-(3,4-difluoroanilino)-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 3687826) has the molecular formula C13H9F2NO3S and a molecular weight of 297.28 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3687826 |
| Molecular Formula | C13H9F2NO3S |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cccs1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H9F2NO3S/c14-9-4-3-8(6-10(9)15)16-12(17)7-19-13(18)11-2-1-5-20-11/h1-6H,7H2,(H,16,17) |
| InChIKey | GKJKGLWMZGXRJV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |