C13H12N2O5S2 — CID 5029047
[2-oxo-2-(3-sulfamoylanilino)ethyl] thiophene-2-carboxylate (PubChem CID 5029047) has the molecular formula C13H12N2O5S2 and a molecular weight of 340.38 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] thiophene-2-carboxylate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 5029047 |
| Molecular Formula | C13H12N2O5S2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] thiophene-2-carboxylate |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C13H12N2O5S2/c14-22(18,19)10-4-1-3-9(7-10)15-12(16)8-20-13(17)11-5-2-6-21-11/h1-7H,8H2,(H,15,16)(H2,14,18,19) |
| InChIKey | QZEMXQNFYAKPNL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |