C16H15ClN2O7S2 — CID 55311692
[2-oxo-2-(3-sulfamoylanilino)ethyl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 55311692) has the molecular formula C16H15ClN2O7S2 and a molecular weight of 446.89 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 55311692 |
| Molecular Formula | C16H15ClN2O7S2 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)Nc2cccc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C16H15ClN2O7S2/c1-27(22,23)11-5-6-14(17)13(8-11)16(21)26-9-15(20)19-10-3-2-4-12(7-10)28(18,24)25/h2-8H,9H2,1H3,(H,19,20)(H2,18,24,25) |
| InChIKey | BCLJTRSQVRPEOA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |