C22H18ClNO6S — CID 2503248
[2-oxo-2-(4-phenoxyanilino)ethyl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 2503248) has the molecular formula C22H18ClNO6S and a molecular weight of 459.91 g/mol. Its IUPAC name is [2-oxo-2-(4-phenoxyanilino)ethyl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2503248 |
| Molecular Formula | C22H18ClNO6S |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | [2-oxo-2-(4-phenoxyanilino)ethyl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)Nc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C22H18ClNO6S/c1-31(27,28)18-11-12-20(23)19(13-18)22(26)29-14-21(25)24-15-7-9-17(10-8-15)30-16-5-3-2-4-6-16/h2-13H,14H2,1H3,(H,24,25) |
| InChIKey | DDOUYPHFPGHFST-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |