C12H12ClNO7S — CID 7725690
[2-(methoxycarbonylamino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 7725690) has the molecular formula C12H12ClNO7S and a molecular weight of 349.75 g/mol. Its IUPAC name is [2-(methoxycarbonylamino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [2-(methoxycarbonylamino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7725690 |
| Molecular Formula | C12H12ClNO7S |
| Molecular Weight | 349.75 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | [2-(methoxycarbonylamino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | COC(=O)NC(=O)COC(=O)c1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C12H12ClNO7S/c1-20-12(17)14-10(15)6-21-11(16)8-5-7(22(2,18)19)3-4-9(8)13/h3-5H,6H2,1-2H3,(H,14,15,17) |
| InChIKey | KTCVPCHVPNJQJK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.75 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |