C14H18ClNO5S — CID 2502676
[2-(tert-butylamino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 2502676) has the molecular formula C14H18ClNO5S and a molecular weight of 347.82 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2502676 |
| Molecular Formula | C14H18ClNO5S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CC(C)(C)NC(=O)COC(=O)c1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C14H18ClNO5S/c1-14(2,3)16-12(17)8-21-13(18)10-7-9(22(4,19)20)5-6-11(10)15/h5-7H,8H2,1-4H3,(H,16,17) |
| InChIKey | IHLRWZGXJFZQRH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |