C14H19FN2O5S — CID 18085308
[2-(tert-butylamino)-2-oxoethyl] 2-fluoro-5-(methylsulfamoyl)benzoate (PubChem CID 18085308) has the molecular formula C14H19FN2O5S and a molecular weight of 346.38 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 2-fluoro-5-(methylsulfamoyl)benzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 2-fluoro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18085308 |
| Molecular Formula | C14H19FN2O5S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 2-fluoro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)OCC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C14H19FN2O5S/c1-14(2,3)17-12(18)8-22-13(19)10-7-9(5-6-11(10)15)23(20,21)16-4/h5-7,16H,8H2,1-4H3,(H,17,18) |
| InChIKey | FGAUCCYZUXOQHQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |