C18H17FN2O6S — CID 55313015
[2-(3-acetylanilino)-2-oxoethyl] 2-fluoro-5-(methylsulfamoyl)benzoate (PubChem CID 55313015) has the molecular formula C18H17FN2O6S and a molecular weight of 408.41 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] 2-fluoro-5-(methylsulfamoyl)benzoate.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] 2-fluoro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55313015 |
| Molecular Formula | C18H17FN2O6S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] 2-fluoro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)OCC(=O)Nc2cccc(C(C)=O)c2)c1 |
| InChI | InChI=1S/C18H17FN2O6S/c1-11(22)12-4-3-5-13(8-12)21-17(23)10-27-18(24)15-9-14(6-7-16(15)19)28(25,26)20-2/h3-9,20H,10H2,1-2H3,(H,21,23) |
| InChIKey | RRBZJCURXUJRGU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |