C16H14Cl2N2O5S — CID 2607600
[2-(3,4-dichloroanilino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate (PubChem CID 2607600) has the molecular formula C16H14Cl2N2O5S and a molecular weight of 417.27 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2607600 |
| Molecular Formula | C16H14Cl2N2O5S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | [2-(3,4-dichloroanilino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H14Cl2N2O5S/c1-19-26(23,24)12-4-2-3-10(7-12)16(22)25-9-15(21)20-11-5-6-13(17)14(18)8-11/h2-8,19H,9H2,1H3,(H,20,21) |
| InChIKey | LDHJJRQMJBCSJV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |