C17H16N2O7S — CID 9320921
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate (PubChem CID 9320921) has the molecular formula C17H16N2O7S and a molecular weight of 392.39 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 9320921 |
| Molecular Formula | C17H16N2O7S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)OCC(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C17H16N2O7S/c1-18-27(22,23)13-4-2-3-11(7-13)17(21)24-9-16(20)19-12-5-6-14-15(8-12)26-10-25-14/h2-8,18H,9-10H2,1H3,(H,19,20) |
| InChIKey | UDPKHLAKXCUJRT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |