C18H17NO7 — CID 2518258
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3,5-dimethoxybenzoate (PubChem CID 2518258) has the molecular formula C18H17NO7 and a molecular weight of 359.33 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3,5-dimethoxybenzoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 2518258 |
| Molecular Formula | C18H17NO7 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCC(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C18H17NO7/c1-22-13-5-11(6-14(8-13)23-2)18(21)24-9-17(20)19-12-3-4-15-16(7-12)26-10-25-15/h3-8H,9-10H2,1-2H3,(H,19,20) |
| InChIKey | VNSIVDGOEACNRI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |