C17H14ClNO6 — CID 50929778
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-chloro-2-methoxybenzoate (PubChem CID 50929778) has the molecular formula C17H14ClNO6 and a molecular weight of 363.75 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-chloro-2-methoxybenzoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 50929778 |
| Molecular Formula | C17H14ClNO6 |
| Molecular Weight | 363.75 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-chloro-2-methoxybenzoate |
| SMILES | COc1cc(Cl)ccc1C(=O)OCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14ClNO6/c1-22-14-6-10(18)2-4-12(14)17(21)23-8-16(20)19-11-3-5-13-15(7-11)25-9-24-13/h2-7H,8-9H2,1H3,(H,19,20) |
| InChIKey | RZFJVKJJQLJNOC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |